C23H26N2O3 — CID 163175410
(4aS,9aS)-2-(2-phenoxyacetyl)-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one (PubChem CID 163175410) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (4aS,9aS)-2-(2-phenoxyacetyl)-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one.
| Compound Name | (4aS,9aS)-2-(2-phenoxyacetyl)-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
|---|---|
| PubChem CID | 163175410 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (4aS,9aS)-2-(2-phenoxyacetyl)-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
| SMILES | O=C(COc1ccccc1)N1CC[C@H]2CC(=O)N(c3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C23H26N2O3/c26-22-15-18-11-13-24(23(27)17-28-21-9-5-2-6-10-21)16-19(18)12-14-25(22)20-7-3-1-4-8-20/h1-10,18-19H,11-17H2/t18-,19+/m0/s1 |
| InChIKey | XATVPSOYFDXKCB-RBUKOAKNSA-N |
| XLogP | 3.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |