C21H29N3O4 — CID 162803731
N-[2-[(4aS,9aS)-6-oxo-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-7-yl]ethyl]acetamide (PubChem CID 162803731) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[2-[(4aS,9aS)-6-oxo-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-7-yl]ethyl]acetamide.
| Compound Name | N-[2-[(4aS,9aS)-6-oxo-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-7-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 162803731 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-[2-[(4aS,9aS)-6-oxo-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-7-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CC[C@@H]2CN(C(=O)COc3ccccc3)CC[C@H]2CC1=O |
| InChI | InChI=1S/C21H29N3O4/c1-16(25)22-9-12-23-10-8-18-14-24(11-7-17(18)13-20(23)26)21(27)15-28-19-5-3-2-4-6-19/h2-6,17-18H,7-15H2,1H3,(H,22,25)/t17-,18+/m0/s1 |
| InChIKey | YMKLBHGVCGFSGL-ZWKOTPCHSA-N |
| XLogP | 1.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |