C20H27N3O4 — CID 100747142
N-[2-oxo-2-[[(3R)-1-(2-phenoxyacetyl)pyrrolidin-3-yl]amino]ethyl]cyclopentanecarboxamide (PubChem CID 100747142) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-oxo-2-[[(3R)-1-(2-phenoxyacetyl)pyrrolidin-3-yl]amino]ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-oxo-2-[[(3R)-1-(2-phenoxyacetyl)pyrrolidin-3-yl]amino]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 100747142 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-oxo-2-[[(3R)-1-(2-phenoxyacetyl)pyrrolidin-3-yl]amino]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCC1)N[C@@H]1CCN(C(=O)COc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O4/c24-18(12-21-20(26)15-6-4-5-7-15)22-16-10-11-23(13-16)19(25)14-27-17-8-2-1-3-9-17/h1-3,8-9,15-16H,4-7,10-14H2,(H,21,26)(H,22,24)/t16-/m1/s1 |
| InChIKey | LNFSMPBQFCPGTM-MRXNPFEDSA-N |
| XLogP | 1.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |