C18H26N2O3 — CID 124831033
1-[(5aS,9aR)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-phenoxyethanone (PubChem CID 124831033) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(5aS,9aR)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-phenoxyethanone.
| Compound Name | 1-[(5aS,9aR)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 124831033 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[(5aS,9aR)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-phenoxyethanone |
| SMILES | CCN1CCO[C@H]2CN(C(=O)COc3ccccc3)CC[C@H]2C1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-19-10-11-22-17-13-20(9-8-15(17)12-19)18(21)14-23-16-6-4-3-5-7-16/h3-7,15,17H,2,8-14H2,1H3/t15-,17-/m0/s1 |
| InChIKey | LKSHSWBGPPBFBV-RDJZCZTQSA-N |
| XLogP | 1.63 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |