C17H26N2O3S — CID 124789899
1-[(5aS,9aR)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-thiophen-2-ylethanone (PubChem CID 124789899) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[(5aS,9aR)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(5aS,9aR)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 124789899 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(5aS,9aR)-4-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-2-thiophen-2-ylethanone |
| SMILES | COCCN1CCO[C@H]2CN(C(=O)Cc3cccs3)CC[C@H]2C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-21-8-6-18-7-9-22-16-13-19(5-4-14(16)12-18)17(20)11-15-3-2-10-23-15/h2-3,10,14,16H,4-9,11-13H2,1H3/t14-,16-/m0/s1 |
| InChIKey | GQDPLVUFVHJHCH-HOCLYGCPSA-N |
| XLogP | 1.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |