C13H15NO5S — CID 115918355
1-(2-thiophen-2-ylacetyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918355) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylacetyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(2-thiophen-2-ylacetyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918355 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(2-thiophen-2-ylacetyl)piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Cc2cccs2)CC1C(=O)O |
| InChI | InChI=1S/C13H15NO5S/c15-11(6-8-2-1-5-20-8)14-4-3-9(12(16)17)10(7-14)13(18)19/h1-2,5,9-10H,3-4,6-7H2,(H,16,17)(H,18,19) |
| InChIKey | DOMUKUJRXLURGK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |