C11H13NO3S — CID 94917211
(3S)-1-(2-thiophen-2-ylacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 94917211) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is (3S)-1-(2-thiophen-2-ylacetyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2-thiophen-2-ylacetyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 94917211 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (3S)-1-(2-thiophen-2-ylacetyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN(C(=O)Cc2cccs2)C1 |
| InChI | InChI=1S/C11H13NO3S/c13-10(6-9-2-1-5-16-9)12-4-3-8(7-12)11(14)15/h1-2,5,8H,3-4,6-7H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | LBBDGISAKPDZNP-QMMMGPOBSA-N |
| XLogP | 1.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |