C18H26N2O4 — CID 97420193
1-[(5aS,8aS)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 97420193) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(5aS,8aS)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(5aS,8aS)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 97420193 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[(5aS,8aS)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | CCN1CCO[C@@H]2CN(C(=O)COc3ccccc3OC)C[C@@H]2C1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-19-8-9-23-17-12-20(11-14(17)10-19)18(21)13-24-16-7-5-4-6-15(16)22-2/h4-7,14,17H,3,8-13H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | XZVQYDVLDQYXQU-WMLDXEAASA-N |
| XLogP | 1.25 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |