C17H23ClN2O3 — CID 124795503
[(5aR,8aR)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-chloro-5-methoxyphenyl)methanone (PubChem CID 124795503) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is [(5aR,8aR)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-chloro-5-methoxyphenyl)methanone.
| Compound Name | [(5aR,8aR)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-chloro-5-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 124795503 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(5aR,8aR)-4-ethyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-chloro-5-methoxyphenyl)methanone |
| SMILES | CCN1CCO[C@H]2CN(C(=O)c3cc(OC)ccc3Cl)C[C@H]2C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-3-19-6-7-23-16-11-20(10-12(16)9-19)17(21)14-8-13(22-2)4-5-15(14)18/h4-5,8,12,16H,3,6-7,9-11H2,1-2H3/t12-,16+/m1/s1 |
| InChIKey | JBHXIMWLBVPSQZ-WBMJQRKESA-N |
| XLogP | 2.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |