C24H22ClNO3 — CID 172670850
[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-(2-chloro-5-methoxyphenyl)naphthalen-1-yl]methanone (PubChem CID 172670850) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is [(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-(2-chloro-5-methoxyphenyl)naphthalen-1-yl]methanone.
| Compound Name | [(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-(2-chloro-5-methoxyphenyl)naphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 172670850 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-(2-chloro-5-methoxyphenyl)naphthalen-1-yl]methanone |
| SMILES | COc1ccc(Cl)c(-c2ccc(C(=O)N3C[C@H]4COC[C@H]4C3)c3ccccc23)c1 |
| InChI | InChI=1S/C24H22ClNO3/c1-28-17-6-9-23(25)22(10-17)20-7-8-21(19-5-3-2-4-18(19)20)24(27)26-11-15-13-29-14-16(15)12-26/h2-10,15-16H,11-14H2,1H3/t15-,16+ |
| InChIKey | WWTYKLUAAMAGQS-IYBDPMFKSA-N |
| XLogP | 4.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |