C27H34N2O5 — CID 26742543
(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one (PubChem CID 26742543) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one.
| Compound Name | (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
|---|---|
| PubChem CID | 26742543 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(2-phenoxyacetyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
| SMILES | COc1cccc(CCN2CC[C@H]3CN(C(=O)COc4ccccc4)CC[C@H]3CC2=O)c1OC |
| InChI | InChI=1S/C27H34N2O5/c1-32-24-10-6-7-20(27(24)33-2)11-14-28-15-13-22-18-29(16-12-21(22)17-25(28)30)26(31)19-34-23-8-4-3-5-9-23/h3-10,21-22H,11-19H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | TUSSQMKFIYBBGY-VXKWHMMOSA-N |
| XLogP | 3.41 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |