C24H31N3O5 — CID 26742562
(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one (PubChem CID 26742562) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one.
| Compound Name | (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
|---|---|
| PubChem CID | 26742562 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-2-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
| SMILES | COc1cccc(CCN2CC[C@H]3CN(C(=O)c4cc(C)on4)CC[C@H]3CC2=O)c1OC |
| InChI | InChI=1S/C24H31N3O5/c1-16-13-20(25-32-16)24(29)27-12-8-18-14-22(28)26(11-9-19(18)15-27)10-7-17-5-4-6-21(30-2)23(17)31-3/h4-6,13,18-19H,7-12,14-15H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | NPPAKQTXNNUGNA-OALUTQOASA-N |
| XLogP | 2.94 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |