C27H32N2O6 — CID 26742561
2-[(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-6-oxo-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepine-2-carbonyl]benzoic acid (PubChem CID 26742561) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-[(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-6-oxo-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepine-2-carbonyl]benzoic acid.
| Compound Name | 2-[(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-6-oxo-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepine-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 26742561 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[(4aS,9aR)-7-[2-(2,3-dimethoxyphenyl)ethyl]-6-oxo-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepine-2-carbonyl]benzoic acid |
| SMILES | COc1cccc(CCN2CC[C@H]3CN(C(=O)c4ccccc4C(=O)O)CC[C@H]3CC2=O)c1OC |
| InChI | InChI=1S/C27H32N2O6/c1-34-23-9-5-6-18(25(23)35-2)10-13-28-14-12-20-17-29(15-11-19(20)16-24(28)30)26(31)21-7-3-4-8-22(21)27(32)33/h3-9,19-20H,10-17H2,1-2H3,(H,32,33)/t19-,20-/m0/s1 |
| InChIKey | SJGXZDTWTFBLDP-PMACEKPBSA-N |
| XLogP | 3.35 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |