C21H20N2O — CID 146046516
(3aS,6aS)-5-[[2-(2-phenylethynyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 146046516) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is (3aS,6aS)-5-[[2-(2-phenylethynyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-[[2-(2-phenylethynyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 146046516 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (3aS,6aS)-5-[[2-(2-phenylethynyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CN(Cc3ccccc3C#Cc3ccccc3)C[C@H]2N1 |
| InChI | InChI=1S/C21H20N2O/c24-21-12-19-14-23(15-20(19)22-21)13-18-9-5-4-8-17(18)11-10-16-6-2-1-3-7-16/h1-9,19-20H,12-15H2,(H,22,24)/t19-,20+/m0/s1 |
| InChIKey | ZHWSESMPWMTMEV-VQTJNVASSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|