C13H13NO — CID 10821857
4-(4-phenylbut-3-ynyl)azetidin-2-one (PubChem CID 10821857) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-(4-phenylbut-3-ynyl)azetidin-2-one.
| Compound Name | 4-(4-phenylbut-3-ynyl)azetidin-2-one |
|---|---|
| PubChem CID | 10821857 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-(4-phenylbut-3-ynyl)azetidin-2-one |
| SMILES | O=C1CC(CCC#Cc2ccccc2)N1 |
| InChI | InChI=1S/C13H13NO/c15-13-10-12(14-13)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7,12H,5,9-10H2,(H,14,15) |
| InChIKey | WRMVKSJAWIGFEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|