C13H17NO3S2 — CID 124869526
(1R,4S,7S)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.1]heptane (PubChem CID 124869526) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is (1R,4S,7S)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S,7S)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 124869526 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (1R,4S,7S)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.1]heptane |
| SMILES | C=CCO[C@H]1[C@H]2CC[C@H]1N(S(=O)(=O)c1cccs1)C2 |
| InChI | InChI=1S/C13H17NO3S2/c1-2-7-17-13-10-5-6-11(13)14(9-10)19(15,16)12-4-3-8-18-12/h2-4,8,10-11,13H,1,5-7,9H2/t10-,11+,13-/m0/s1 |
| InChIKey | SKOUSHGXBBWDQA-LOWVWBTDSA-N |
| XLogP | 2.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|