C14H20N2O3S2 — CID 97403353
(7R,8aS)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97403353) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (7R,8aS)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97403353 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (7R,8aS)-7-prop-2-enoxy-2-thiophen-2-ylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C=CCO[C@@H]1C[C@H]2CN(S(=O)(=O)c3cccs3)CCN2C1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-2-7-19-13-9-12-10-16(6-5-15(12)11-13)21(17,18)14-4-3-8-20-14/h2-4,8,12-13H,1,5-7,9-11H2/t12-,13+/m0/s1 |
| InChIKey | HMAZTXUCCAKGDL-QWHCGFSZSA-N |
| XLogP | 1.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|