C18H22N4O6S2 — CID 4501487
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-thiophen-2-ylsulfonylmorpholine (PubChem CID 4501487) has the molecular formula C18H22N4O6S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-thiophen-2-ylsulfonylmorpholine.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-thiophen-2-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 4501487 |
| Molecular Formula | C18H22N4O6S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-thiophen-2-ylsulfonylmorpholine |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(S(=O)(=O)c3cccs3)CCO2)n1 |
| InChI | InChI=1S/C18H22N4O6S2/c1-3-8-26-16-19-17(27-9-4-2)21-18(20-16)28-13-14-12-22(7-10-25-14)30(23,24)15-6-5-11-29-15/h3-6,11,14H,1-2,7-10,12-13H2 |
| InChIKey | CHPFDDZCWLUWFU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 112.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|