C20H26N4O4S — CID 3745600
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(3-methylthiophen-2-yl)methyl]morpholine (PubChem CID 3745600) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(3-methylthiophen-2-yl)methyl]morpholine.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(3-methylthiophen-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 3745600 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[(3-methylthiophen-2-yl)methyl]morpholine |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(Cc3sccc3C)CCO2)n1 |
| InChI | InChI=1S/C20H26N4O4S/c1-4-8-26-18-21-19(27-9-5-2)23-20(22-18)28-14-16-12-24(7-10-25-16)13-17-15(3)6-11-29-17/h4-6,11,16H,1-2,7-10,12-14H2,3H3 |
| InChIKey | JRCVJBWVXIWGEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|