C29H30N4O5 — CID 3442233
1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone (PubChem CID 3442233) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone.
| Compound Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone |
|---|---|
| PubChem CID | 3442233 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C(=O)CC3c4ccccc4-c4ccccc43)CCO2)n1 |
| InChI | InChI=1S/C29H30N4O5/c1-3-14-36-27-30-28(37-15-4-2)32-29(31-27)38-19-20-18-33(13-16-35-20)26(34)17-25-23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h3-12,20,25H,1-2,13-19H2 |
| InChIKey | CKPVYAMYWKCNFD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|