C28H26FNO4 — CID 3768585
1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone (PubChem CID 3768585) has the molecular formula C28H26FNO4 and a molecular weight of 459.52 g/mol. Its IUPAC name is 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone.
| Compound Name | 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone |
|---|---|
| PubChem CID | 3768585 |
| Molecular Formula | C28H26FNO4 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-(9H-fluoren-9-yl)ethanone |
| SMILES | CC(=O)c1ccc(OCC2CN(C(=O)CC3c4ccccc4-c4ccccc43)CCO2)cc1F |
| InChI | InChI=1S/C28H26FNO4/c1-18(31)21-11-10-19(14-27(21)29)34-17-20-16-30(12-13-33-20)28(32)15-26-24-8-4-2-6-22(24)23-7-3-5-9-25(23)26/h2-11,14,20,26H,12-13,15-17H2,1H3 |
| InChIKey | WJNMBAOZDFSPLD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |