C19H20FNO4S — CID 3847500
1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-thiophen-3-ylethanone (PubChem CID 3847500) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 3847500 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-[2-[(4-acetyl-3-fluorophenoxy)methyl]morpholin-4-yl]-2-thiophen-3-ylethanone |
| SMILES | CC(=O)c1ccc(OCC2CN(C(=O)Cc3ccsc3)CCO2)cc1F |
| InChI | InChI=1S/C19H20FNO4S/c1-13(22)17-3-2-15(9-18(17)20)25-11-16-10-21(5-6-24-16)19(23)8-14-4-7-26-12-14/h2-4,7,9,12,16H,5-6,8,10-11H2,1H3 |
| InChIKey | RGFFBGRZYUAGSI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |