C24H24FNO4 — CID 3820439
1-[2-fluoro-4-[[4-(3-methyl-1H-indene-2-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone (PubChem CID 3820439) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[2-fluoro-4-[[4-(3-methyl-1H-indene-2-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone.
| Compound Name | 1-[2-fluoro-4-[[4-(3-methyl-1H-indene-2-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 3820439 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[2-fluoro-4-[[4-(3-methyl-1H-indene-2-carbonyl)morpholin-2-yl]methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC2CN(C(=O)C3=C(C)c4ccccc4C3)CCO2)cc1F |
| InChI | InChI=1S/C24H24FNO4/c1-15-20-6-4-3-5-17(20)11-22(15)24(28)26-9-10-29-19(13-26)14-30-18-7-8-21(16(2)27)23(25)12-18/h3-8,12,19H,9-11,13-14H2,1-2H3 |
| InChIKey | JLKMODWLLAFAIU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |