C25H33N5O6S — CID 3777711
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-N-[2-(2,5-dimethoxyphenyl)ethyl]morpholine-4-carbothioamide (PubChem CID 3777711) has the molecular formula C25H33N5O6S and a molecular weight of 531.64 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-N-[2-(2,5-dimethoxyphenyl)ethyl]morpholine-4-carbothioamide.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-N-[2-(2,5-dimethoxyphenyl)ethyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3777711 |
| Molecular Formula | C25H33N5O6S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-N-[2-(2,5-dimethoxyphenyl)ethyl]morpholine-4-carbothioamide |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C(=S)NCCc3cc(OC)ccc3OC)CCO2)n1 |
| InChI | InChI=1S/C25H33N5O6S/c1-5-12-34-22-27-23(35-13-6-2)29-24(28-22)36-17-20-16-30(11-14-33-20)25(37)26-10-9-18-15-19(31-3)7-8-21(18)32-4/h5-8,15,20H,1-2,9-14,16-17H2,3-4H3,(H,26,37) |
| InChIKey | NIDKVTFKXXPTQO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|