C17H23NO6 — CID 119248755
2-[4-[3-(2,5-dimethoxyphenyl)propanoyl]morpholin-2-yl]acetic acid (PubChem CID 119248755) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[4-[3-(2,5-dimethoxyphenyl)propanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(2,5-dimethoxyphenyl)propanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248755 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[4-[3-(2,5-dimethoxyphenyl)propanoyl]morpholin-2-yl]acetic acid |
| SMILES | COc1ccc(OC)c(CCC(=O)N2CCOC(CC(=O)O)C2)c1 |
| InChI | InChI=1S/C17H23NO6/c1-22-13-4-5-15(23-2)12(9-13)3-6-16(19)18-7-8-24-14(11-18)10-17(20)21/h4-5,9,14H,3,6-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | YRMSLQXRTIMVDG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |