C18H23NO6 — CID 120687850
2-[4-[5-(4-methoxyphenyl)-5-oxopentanoyl]morpholin-2-yl]acetic acid (PubChem CID 120687850) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-[4-[5-(4-methoxyphenyl)-5-oxopentanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[5-(4-methoxyphenyl)-5-oxopentanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 120687850 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[4-[5-(4-methoxyphenyl)-5-oxopentanoyl]morpholin-2-yl]acetic acid |
| SMILES | COc1ccc(C(=O)CCCC(=O)N2CCOC(CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-24-14-7-5-13(6-8-14)16(20)3-2-4-17(21)19-9-10-25-15(12-19)11-18(22)23/h5-8,15H,2-4,9-12H2,1H3,(H,22,23) |
| InChIKey | KLACZIWHDVCRJO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |