C13H21NO6 — CID 115534065
6-[2-(2-methoxy-2-oxoethyl)morpholin-4-yl]-6-oxohexanoic acid (PubChem CID 115534065) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 6-[2-(2-methoxy-2-oxoethyl)morpholin-4-yl]-6-oxohexanoic acid.
| Compound Name | 6-[2-(2-methoxy-2-oxoethyl)morpholin-4-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 115534065 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-[2-(2-methoxy-2-oxoethyl)morpholin-4-yl]-6-oxohexanoic acid |
| SMILES | COC(=O)CC1CN(C(=O)CCCCC(=O)O)CCO1 |
| InChI | InChI=1S/C13H21NO6/c1-19-13(18)8-10-9-14(6-7-20-10)11(15)4-2-3-5-12(16)17/h10H,2-9H2,1H3,(H,16,17) |
| InChIKey | HSSUBEILYSNLKQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|