C12H18N2O6 — CID 115535465
1-[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]azetidine-3-carboxylic acid (PubChem CID 115535465) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115535465 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]azetidine-3-carboxylic acid |
| SMILES | COC(=O)CC1CN(C(=O)N2CC(C(=O)O)C2)CCO1 |
| InChI | InChI=1S/C12H18N2O6/c1-19-10(15)4-9-7-13(2-3-20-9)12(18)14-5-8(6-14)11(16)17/h8-9H,2-7H2,1H3,(H,16,17) |
| InChIKey | DMKOLWIUVCKCBS-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |