C13H22N2O6 — CID 115535493
(2R)-2-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 115535493) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-2-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115535493 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R)-2-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | COC(=O)CC1CN(C(=O)N[C@@H](C(=O)O)C(C)C)CCO1 |
| InChI | InChI=1S/C13H22N2O6/c1-8(2)11(12(17)18)14-13(19)15-4-5-21-9(7-15)6-10(16)20-3/h8-9,11H,4-7H2,1-3H3,(H,14,19)(H,17,18)/t9?,11-/m1/s1 |
| InChIKey | QFHKZZKXEXSRCA-HCCKASOXSA-N |
| XLogP | 0.07 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |