C19H26N2O6 — CID 122027734
4-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid (PubChem CID 122027734) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027734 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[[2-(2-methoxy-2-oxoethyl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid |
| SMILES | COC(=O)CC1CN(C(=O)NC(CCC(=O)O)Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C19H26N2O6/c1-26-18(24)12-16-13-21(9-10-27-16)19(25)20-15(7-8-17(22)23)11-14-5-3-2-4-6-14/h2-6,15-16H,7-13H2,1H3,(H,20,25)(H,22,23) |
| InChIKey | QJBCBOCEOWSIIU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |