C13H22N2O4S — CID 115534739
methyl 2-[4-(2-carbamothioyl-3-methylbutanoyl)morpholin-2-yl]acetate (PubChem CID 115534739) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl 2-[4-(2-carbamothioyl-3-methylbutanoyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(2-carbamothioyl-3-methylbutanoyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 115534739 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl 2-[4-(2-carbamothioyl-3-methylbutanoyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)C(C(N)=S)C(C)C)CCO1 |
| InChI | InChI=1S/C13H22N2O4S/c1-8(2)11(12(14)20)13(17)15-4-5-19-9(7-15)6-10(16)18-3/h8-9,11H,4-7H2,1-3H3,(H2,14,20) |
| InChIKey | AJFGKFJKTCLLKQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|