C24H29N5O4S — CID 3672617
N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholine-4-carbothioamide (PubChem CID 3672617) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholine-4-carbothioamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3672617 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholine-4-carbothioamide |
| SMILES | COc1ccc(OC)c(CCNC(=S)N2CCOC(COc3ccc(-n4cncn4)cc3)C2)c1 |
| InChI | InChI=1S/C24H29N5O4S/c1-30-21-7-8-23(31-2)18(13-21)9-10-26-24(34)28-11-12-32-22(14-28)15-33-20-5-3-19(4-6-20)29-17-25-16-27-29/h3-8,13,16-17,22H,9-12,14-15H2,1-2H3,(H,26,34) |
| InChIKey | YZIMDHYDRKSOAV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|