C24H26N4O3S — CID 74224102
3-[(Z)-2-phenylethenyl]sulfanyl-1-[2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholin-4-yl]propan-1-one (PubChem CID 74224102) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-[(Z)-2-phenylethenyl]sulfanyl-1-[2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholin-4-yl]propan-1-one.
| Compound Name | 3-[(Z)-2-phenylethenyl]sulfanyl-1-[2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 74224102 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-[(Z)-2-phenylethenyl]sulfanyl-1-[2-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]morpholin-4-yl]propan-1-one |
| SMILES | O=C(CCS/C=C\c1ccccc1)N1CCOC(COc2ccc(-n3cncn3)cc2)C1 |
| InChI | InChI=1S/C24H26N4O3S/c29-24(11-15-32-14-10-20-4-2-1-3-5-20)27-12-13-30-23(16-27)17-31-22-8-6-21(7-9-22)28-19-25-18-26-28/h1-10,14,18-19,23H,11-13,15-17H2/b14-10- |
| InChIKey | ZWWIGSIRLYWYLK-UVTDQMKNSA-N |
| XLogP | 3.67 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|