C25H27NO4S — CID 3868696
4-[[4-[3-(2-phenylethenylsulfanyl)propanoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one (PubChem CID 3868696) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[[4-[3-(2-phenylethenylsulfanyl)propanoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one.
| Compound Name | 4-[[4-[3-(2-phenylethenylsulfanyl)propanoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 3868696 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[[4-[3-(2-phenylethenylsulfanyl)propanoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c(OCC3CN(C(=O)CCSC=Cc4ccccc4)CCO3)cccc21 |
| InChI | InChI=1S/C25H27NO4S/c27-23-10-9-22-21(23)7-4-8-24(22)30-18-20-17-26(13-14-29-20)25(28)12-16-31-15-11-19-5-2-1-3-6-19/h1-8,11,15,20H,9-10,12-14,16-18H2 |
| InChIKey | WZHBRZQEOFZERJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|