C28H36BN2O10 — CID 174024033
CID 174024033 (PubChem CID 174024033) has the molecular formula C28H36BN2O10 and a molecular weight of 571.41 g/mol.
| Compound Name | CID 174024033 |
|---|---|
| PubChem CID | 174024033 |
| Molecular Formula | C28H36BN2O10 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | — |
| SMILES | CCOc1ccccc1OCC1CN(C(=O)O[B]OC(=O)N2CCOC(COc3ccccc3OCC)C2)CCO1 |
| InChI | InChI=1S/C28H36BN2O10/c1-3-34-23-9-5-7-11-25(23)38-19-21-17-30(13-15-36-21)27(32)40-29-41-28(33)31-14-16-37-22(18-31)20-39-26-12-8-6-10-24(26)35-4-2/h5-12,21-22H,3-4,13-20H2,1-2H3 |
| InChIKey | JXYZBZCFGDKHBG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|