C23H34N2O8 — CID 174172827
2-[(2R)-2-acetamido-3-methylbutanoyl]oxyethyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate (PubChem CID 174172827) has the molecular formula C23H34N2O8 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[(2R)-2-acetamido-3-methylbutanoyl]oxyethyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate.
| Compound Name | 2-[(2R)-2-acetamido-3-methylbutanoyl]oxyethyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 174172827 |
| Molecular Formula | C23H34N2O8 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 2-[(2R)-2-acetamido-3-methylbutanoyl]oxyethyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate |
| SMILES | CCOc1ccccc1OCC1CN(C(=O)OCCOC(=O)[C@H](NC(C)=O)C(C)C)CCO1 |
| InChI | InChI=1S/C23H34N2O8/c1-5-29-19-8-6-7-9-20(19)33-15-18-14-25(10-11-30-18)23(28)32-13-12-31-22(27)21(16(2)3)24-17(4)26/h6-9,16,18,21H,5,10-15H2,1-4H3,(H,24,26)/t18?,21-/m1/s1 |
| InChIKey | IYCXDBJQKCENOX-BDPMCISCSA-N |
| XLogP | 2.01 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|