C22H34N2O7 — CID 170209359
1-[(2S)-3-methyl-2-(methylamino)butanoyl]oxyethyl (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate (PubChem CID 170209359) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-[(2S)-3-methyl-2-(methylamino)butanoyl]oxyethyl (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate.
| Compound Name | 1-[(2S)-3-methyl-2-(methylamino)butanoyl]oxyethyl (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170209359 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[(2S)-3-methyl-2-(methylamino)butanoyl]oxyethyl (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate |
| SMILES | CCOc1ccccc1OC[C@@H]1CN(C(=O)OC(C)OC(=O)[C@@H](NC)C(C)C)CCO1 |
| InChI | InChI=1S/C22H34N2O7/c1-6-27-18-9-7-8-10-19(18)29-14-17-13-24(11-12-28-17)22(26)31-16(4)30-21(25)20(23-5)15(2)3/h7-10,15-17,20,23H,6,11-14H2,1-5H3/t16?,17-,20-/m0/s1 |
| InChIKey | PLIWNRSNZCIBKM-IZVBFETMSA-N |
| XLogP | 2.43 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|