C29H27NO4 — CID 74224630
4-[[4-[(E)-2,3-diphenylprop-2-enoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one (PubChem CID 74224630) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[[4-[(E)-2,3-diphenylprop-2-enoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one.
| Compound Name | 4-[[4-[(E)-2,3-diphenylprop-2-enoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 74224630 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[[4-[(E)-2,3-diphenylprop-2-enoyl]morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c(OCC3CN(C(=O)/C(=C/c4ccccc4)c4ccccc4)CCO3)cccc21 |
| InChI | InChI=1S/C29H27NO4/c31-27-15-14-25-24(27)12-7-13-28(25)34-20-23-19-30(16-17-33-23)29(32)26(22-10-5-2-6-11-22)18-21-8-3-1-4-9-21/h1-13,18,23H,14-17,19-20H2/b26-18+ |
| InChIKey | HHRBZDQUZHXQCD-NLRVBDNBSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|