C20H19FN2O4 — CID 5103890
4-[[4-(2-fluoropyridine-3-carbonyl)morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one (PubChem CID 5103890) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 4-[[4-(2-fluoropyridine-3-carbonyl)morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one.
| Compound Name | 4-[[4-(2-fluoropyridine-3-carbonyl)morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 5103890 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-[[4-(2-fluoropyridine-3-carbonyl)morpholin-2-yl]methoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c(OCC3CN(C(=O)c4cccnc4F)CCO3)cccc21 |
| InChI | InChI=1S/C20H19FN2O4/c21-19-16(4-2-8-22-19)20(25)23-9-10-26-13(11-23)12-27-18-5-1-3-14-15(18)6-7-17(14)24/h1-5,8,13H,6-7,9-12H2 |
| InChIKey | BCRGNRCUVHFAOH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|