C24H29NO5S — CID 3740231
1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]-2-(2-phenoxyethylsulfanyl)ethanone (PubChem CID 3740231) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]-2-(2-phenoxyethylsulfanyl)ethanone.
| Compound Name | 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]-2-(2-phenoxyethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 3740231 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]-2-(2-phenoxyethylsulfanyl)ethanone |
| SMILES | CC(=O)c1ccc(OCC2CN(C(=O)CSCCOc3ccccc3)CCO2)cc1C |
| InChI | InChI=1S/C24H29NO5S/c1-18-14-21(8-9-23(18)19(2)26)30-16-22-15-25(10-11-28-22)24(27)17-31-13-12-29-20-6-4-3-5-7-20/h3-9,14,22H,10-13,15-17H2,1-2H3 |
| InChIKey | IRJKETLKYPYKOI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|