C19H24N2O5 — CID 3694705
1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide (PubChem CID 3694705) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3694705 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[2-[(4-acetyl-3-methylphenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)c1ccc(OCC2CN(C(=O)C3(C(N)=O)CC3)CCO2)cc1C |
| InChI | InChI=1S/C19H24N2O5/c1-12-9-14(3-4-16(12)13(2)22)26-11-15-10-21(7-8-25-15)18(24)19(5-6-19)17(20)23/h3-4,9,15H,5-8,10-11H2,1-2H3,(H2,20,23) |
| InChIKey | LLEGLABSAKWALY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|