C21H25NO5S — CID 3559114
1-[4-[[4-(3-ethoxythiophene-2-carbonyl)morpholin-2-yl]methoxy]-2-methylphenyl]ethanone (PubChem CID 3559114) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-[4-[[4-(3-ethoxythiophene-2-carbonyl)morpholin-2-yl]methoxy]-2-methylphenyl]ethanone.
| Compound Name | 1-[4-[[4-(3-ethoxythiophene-2-carbonyl)morpholin-2-yl]methoxy]-2-methylphenyl]ethanone |
|---|---|
| PubChem CID | 3559114 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[4-[[4-(3-ethoxythiophene-2-carbonyl)morpholin-2-yl]methoxy]-2-methylphenyl]ethanone |
| SMILES | CCOc1ccsc1C(=O)N1CCOC(COc2ccc(C(C)=O)c(C)c2)C1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-25-19-7-10-28-20(19)21(24)22-8-9-26-17(12-22)13-27-16-5-6-18(15(3)23)14(2)11-16/h5-7,10-11,17H,4,8-9,12-13H2,1-3H3 |
| InChIKey | ULBCDHULEYISLZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |