C19H22BrNO4 — CID 74224273
1-[4-[[4-[(5-bromofuran-2-yl)methyl]morpholin-2-yl]methoxy]-2-methylphenyl]ethanone (PubChem CID 74224273) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 1-[4-[[4-[(5-bromofuran-2-yl)methyl]morpholin-2-yl]methoxy]-2-methylphenyl]ethanone.
| Compound Name | 1-[4-[[4-[(5-bromofuran-2-yl)methyl]morpholin-2-yl]methoxy]-2-methylphenyl]ethanone |
|---|---|
| PubChem CID | 74224273 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 1-[4-[[4-[(5-bromofuran-2-yl)methyl]morpholin-2-yl]methoxy]-2-methylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC2CN(Cc3ccc(Br)o3)CCO2)cc1C |
| InChI | InChI=1S/C19H22BrNO4/c1-13-9-15(3-5-18(13)14(2)22)24-12-17-11-21(7-8-23-17)10-16-4-6-19(20)25-16/h3-6,9,17H,7-8,10-12H2,1-2H3 |
| InChIKey | OFCPEQXXBZYPSJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |