C27H32N4O3 — CID 74228852
3-[4-[[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]methyl]-N-(2-cyanoethyl)anilino]propanenitrile (PubChem CID 74228852) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[4-[[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]methyl]-N-(2-cyanoethyl)anilino]propanenitrile.
| Compound Name | 3-[4-[[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]methyl]-N-(2-cyanoethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 74228852 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-[4-[[2-[(4-acetyl-3-methylphenoxy)methyl]morpholin-4-yl]methyl]-N-(2-cyanoethyl)anilino]propanenitrile |
| SMILES | CC(=O)c1ccc(OCC2CN(Cc3ccc(N(CCC#N)CCC#N)cc3)CCO2)cc1C |
| InChI | InChI=1S/C27H32N4O3/c1-21-17-25(9-10-27(21)22(2)32)34-20-26-19-30(15-16-33-26)18-23-5-7-24(8-6-23)31(13-3-11-28)14-4-12-29/h5-10,17,26H,3-4,13-16,18-20H2,1-2H3 |
| InChIKey | WLJBHPHGELPGCC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|