C24H29NO7 — CID 3859572
[3-[[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]methyl]phenyl] acetate (PubChem CID 3859572) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]methyl]phenyl] acetate.
| Compound Name | [3-[[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 3859572 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [3-[[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]methyl]phenyl] acetate |
| SMILES | COc1ccc(C(C)=O)c(OCC2CN(Cc3cccc(OC(C)=O)c3)CCO2)c1OC |
| InChI | InChI=1S/C24H29NO7/c1-16(26)21-8-9-22(28-3)24(29-4)23(21)31-15-20-14-25(10-11-30-20)13-18-6-5-7-19(12-18)32-17(2)27/h5-9,12,20H,10-11,13-15H2,1-4H3 |
| InChIKey | CWQBGOODJXDMRJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|