C21H29NO6 — CID 4685886
1-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-methylpent-2-en-1-one (PubChem CID 4685886) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 1-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-methylpent-2-en-1-one.
| Compound Name | 1-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-methylpent-2-en-1-one |
|---|---|
| PubChem CID | 4685886 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-methylpent-2-en-1-one |
| SMILES | CCC=C(C)C(=O)N1CCOC(COc2c(C(C)=O)ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C21H29NO6/c1-6-7-14(2)21(24)22-10-11-27-16(12-22)13-28-19-17(15(3)23)8-9-18(25-4)20(19)26-5/h7-9,16H,6,10-13H2,1-5H3 |
| InChIKey | DNMIBJKNZMEPOX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|