C24H28N2O8 — CID 74227353
(Z)-N-[2-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 74227353) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is (Z)-N-[2-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-[2-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 74227353 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (Z)-N-[2-[2-[(6-acetyl-2,3-dimethoxyphenoxy)methyl]morpholin-4-yl]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | COc1ccc(C(C)=O)c(OCC2CN(C(=O)CNC(=O)/C=C\c3ccco3)CCO2)c1OC |
| InChI | InChI=1S/C24H28N2O8/c1-16(27)19-7-8-20(30-2)24(31-3)23(19)34-15-18-14-26(10-12-33-18)22(29)13-25-21(28)9-6-17-5-4-11-32-17/h4-9,11,18H,10,12-15H2,1-3H3,(H,25,28)/b9-6- |
| InChIKey | LECMDWHUUPAKCF-TWGQIWQCSA-N |
| XLogP | 1.94 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|