C18H21FN2O5 — CID 3601027
1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide (PubChem CID 3601027) has the molecular formula C18H21FN2O5 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3601027 |
| Molecular Formula | C18H21FN2O5 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)c1cc(F)ccc1OCC1CN(C(=O)C2(C(N)=O)CC2)CCO1 |
| InChI | InChI=1S/C18H21FN2O5/c1-11(22)14-8-12(19)2-3-15(14)26-10-13-9-21(6-7-25-13)17(24)18(4-5-18)16(20)23/h2-3,8,13H,4-7,9-10H2,1H3,(H2,20,23) |
| InChIKey | DNFNFUSCORFXSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|