C20H25FN2O6 — CID 3857212
2-[[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 3857212) has the molecular formula C20H25FN2O6 and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-[[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 3857212 |
| Molecular Formula | C20H25FN2O6 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholine-4-carbonyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N1CCOC(COc2ccc(F)cc2C(C)=O)C1 |
| InChI | InChI=1S/C20H25FN2O6/c1-13(2)19(25)28-8-6-22-20(26)23-7-9-27-16(11-23)12-29-18-5-4-15(21)10-17(18)14(3)24/h4-5,10,16H,1,6-9,11-12H2,2-3H3,(H,22,26) |
| InChIKey | UWMOICXCVMOUEI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|