C22H24FNO6S — CID 5154703
1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholin-4-yl]-2-(4-methylphenyl)sulfonylethanone (PubChem CID 5154703) has the molecular formula C22H24FNO6S and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholin-4-yl]-2-(4-methylphenyl)sulfonylethanone.
| Compound Name | 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholin-4-yl]-2-(4-methylphenyl)sulfonylethanone |
|---|---|
| PubChem CID | 5154703 |
| Molecular Formula | C22H24FNO6S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-[2-[(2-acetyl-4-fluorophenoxy)methyl]morpholin-4-yl]-2-(4-methylphenyl)sulfonylethanone |
| SMILES | CC(=O)c1cc(F)ccc1OCC1CN(C(=O)CS(=O)(=O)c2ccc(C)cc2)CCO1 |
| InChI | InChI=1S/C22H24FNO6S/c1-15-3-6-19(7-4-15)31(27,28)14-22(26)24-9-10-29-18(12-24)13-30-21-8-5-17(23)11-20(21)16(2)25/h3-8,11,18H,9-10,12-14H2,1-2H3 |
| InChIKey | FTGSSPAXTMTGBZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |